Compound Q&A

How is 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) typically synthesized?

Answer

1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (1:1)
1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) is typically synthesized by a multi-step process. First, 2,4,6-trimethoxybenzene is reacted with methylamine to form 1-(2,4,6-trimethoxyphenyl)methanamine, which is then reacted with hydrochloric acid to form the hydrochloride salt. The yield is around 70-80%, and the reaction is catalyzed by a mild acid or base, depending on the conditions chosen.

About

English Name 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (1:1)
Molecular Formula C10H16ClNO3
Molecular Weight 233.69 g/mol
SMILES COC1=CC(=C(C(=C1)OC)CN)OC.Cl
InChIKey BLFRMOOGAICNSZ-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6)?

1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) is a crystalline solid with a...

Compound Q&A

What industries use 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6)?

1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6)?

When handling 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6), it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...