Compound Q&A

What are the physical and chemical properties of 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6)?

Answer

1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (1:1)
1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) is a crystalline solid with a molecular weight of approximately 310.37 g/mol. It has a melting point of 195-198°C and is soluble in water and organic solvents like methanol and ethanol. It is less reactive than its parent compound, with minimal reactivity towards common chemicals. It is stable under normal conditions but should be stored in airtight containers to prevent hydrolysis.

About

English Name 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (1:1)
Molecular Formula C10H16ClNO3
Molecular Weight 233.69 g/mol
SMILES COC1=CC(=C(C(=C1)OC)CN)OC.Cl
InChIKey BLFRMOOGAICNSZ-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) typically synthesized?

1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) is typically synthesized by a...

Compound Q&A

What industries use 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6)?

1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6)?

When handling 1-(2,4,6-Trimethoxyphenyl)methanamine hydrochloride (CAS: 146548-59-6), it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...