Compound Q&A

What precautions should be taken when handling 2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7)?

Answer

2,3-Dichloro-4-(trifluoromethyl)pyridine
When handling 2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7), it is essential to use proper personal protective equipment (PPE), including gloves, goggles, and a lab coat. This compound should be handled in a fume hood due to its volatility and potential to form toxic fumes. In case of a spill, it should be cleaned up according to the Material Safety Data Sheet (MSDS) guidelines. Always refer to the latest SDS for detailed safety information.

About

CAS No 89719-93-7
English Name 2,3-Dichloro-4-(trifluoromethyl)pyridine
Molecular Formula C6H2Cl2F3N
Molecular Weight 215.99 g/mol
SMILES C1=CN=C(C(=C1C(F)(F)F)Cl)Cl
InChIKey ZFCZNQZILNNPBH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7)?

2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7) is a crystalline solid with a molecular w...

Compound Q&A

How is 2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7) typically synthesized?

2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7) is commonly synthesized via a multistep p...

Compound Q&A

What industries use 2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7)?

2,3-Dichloro-4-(trifluoromethyl)pyridine (CAS: 89719-93-7) is primarily used in the pharmaceutical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...