Compound Q&A

What precautions should be taken when handling 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

Answer

5-Methoxy-1-benzofuran-2-carboxylic acid
When handling 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7), it is important to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to prevent inhalation. In case of a spill, it should be cleaned up carefully, and the area should be flushed with water. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 10242-08-7
English Name 5-Methoxy-1-benzofuran-2-carboxylic acid
Molecular Formula C10H8O4
Molecular Weight 192.17 g/mol
SMILES COC1=CC2=C(C=C1)OC(=C2)C(=O)O
InChIKey XZELWEMGWISCTP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is a crystalline solid with a molecular w...

Compound Q&A

How is 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) typically synthesized?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is typically synthesized through a conden...

Compound Q&A

What industries use 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is used in various industries, including ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...