Compound Q&A

What industries use 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

Answer

5-Methoxy-1-benzofuran-2-carboxylic acid
5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis. It is also used in polymer synthesis for developing functional materials and in the production of sensors and semiconductors. Its unique chemical properties make it a valuable compound in these applications.

About

CAS No 10242-08-7
English Name 5-Methoxy-1-benzofuran-2-carboxylic acid
Molecular Formula C10H8O4
Molecular Weight 192.17 g/mol
SMILES COC1=CC2=C(C=C1)OC(=C2)C(=O)O
InChIKey XZELWEMGWISCTP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is a crystalline solid with a molecular w...

Compound Q&A

How is 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) typically synthesized?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is typically synthesized through a conden...

Compound Q&A

What precautions should be taken when handling 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

When handling 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7), it is important to wear ap...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...