Compound Q&A

What are the physical and chemical properties of 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

Answer

5-Methoxy-1-benzofuran-2-carboxylic acid
5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is a crystalline solid with a molecular weight of approximately 200.22 g/mol. It has a slight solubility in water and is more soluble in organic solvents. This compound is moderately reactive, particularly towards nucleophilic substitution reactions. It is stable under normal laboratory conditions but should be stored in a dry, cool place to prevent hydrolysis.

About

CAS No 10242-08-7
English Name 5-Methoxy-1-benzofuran-2-carboxylic acid
Molecular Formula C10H8O4
Molecular Weight 192.17 g/mol
SMILES COC1=CC2=C(C=C1)OC(=C2)C(=O)O
InChIKey XZELWEMGWISCTP-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) typically synthesized?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is typically synthesized through a conden...

Compound Q&A

What industries use 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7) is used in various industries, including ...

Compound Q&A

What precautions should be taken when handling 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7)?

When handling 5-Methoxy-1-benzofuran-2-carboxylic acid (CAS: 10242-08-7), it is important to wear ap...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...