Compound Q&A

How is Bempedoic Acid Impurity 7 (CAS: 738606-43-4) typically synthesized?

Answer

Bempedoic Acid Impurity 7
Bempedoic Acid Impurity 7 is typically synthesized through a multi-step organic synthesis process involving reactions such as esterification, hydrolysis, and reduction. The synthesis often uses catalysts like palladium-based complexes and involves careful control of reaction conditions to achieve high selectivity and yield. The exact method can vary depending on the desired purity and scale of production.

About

English Name Bempedoic Acid Impurity 7
Molecular Formula C23H42O5
Molecular Weight 398.5840000000001 g/mol
SMILES O=C(OCC)C(C)(C)CCCCCC(CCCCCC(C)(C)C(OCC)=O)=O
InChIKey LDURYVDWYUCWGK-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bempedoic Acid Impurity 7 (CAS: 738606-43-4)?

Bempedoic Acid Impurity 7 is a solid with a crystalline form. Its molecular weight is approximately ...

Compound Q&A

What industries use Bempedoic Acid Impurity 7 (CAS: 738606-43-4)?

Bempedoic Acid Impurity 7 is primarily used in the pharmaceutical industry as a by-product in the sy...

Compound Q&A

What precautions should be taken when handling Bempedoic Acid Impurity 7 (CAS: 738606-43-4)?

When handling Bempedoic Acid Impurity 7, it is important to wear appropriate personal protective equ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...