Compound Q&A

What precautions should be taken when handling 4-Cyclohexylproline (CAS: 9002-01-1)?

Answer

4-Cyclohexylproline
When handling 4-Cyclohexylproline, wear protective gloves, eye protection, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Store it in a cool, dry place away from direct sunlight and heat sources. In case of a spill, clean it up immediately using appropriate cleaning agents and ensure proper disposal according to safety data sheets (SDS) guidelines.

About

CAS No 9002-01-1
English Name 4-Cyclohexylproline
Molecular Formula C11H19NO2
Molecular Weight 197.28 g/mol
SMILES C1CCC(CC1)C2CC(NC2)C(=O)O
InChIKey XRZWVSXEDRYQGC-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Cyclohexylproline (CAS: 9002-01-1)?

The physical properties of 4-Cyclohexylproline include a white crystalline form. Its molecular weigh...

Compound Q&A

How is 4-Cyclohexylproline (CAS: 9002-01-1) typically synthesized?

4-Cyclohexylproline is typically synthesized by the condensation of cyclohexylamine and acrylic acid...

Compound Q&A

What industries use 4-Cyclohexylproline (CAS: 9002-01-1)?

4-Cyclohexylproline is used in various industries. Its amide functionality makes it useful in pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...