Compound Q&A

What are the physical and chemical properties of Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2 (CAS: 99566-27-5)?

Answer

Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2
Neuropeptide FF has a molecular weight of approximately 1060.51 Da. It is a water-soluble peptide and does not crystallize easily. It is relatively stable in acidic and basic conditions but susceptible to degradation by proteases. The compound is known for its high reactivity with certain metal ions and other biochemical reagents.

About

CAS No 99566-27-5
English Name Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2
Molecular Formula C54H76N14O10
Molecular Weight 1081.3 g/mol
SMILES CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCC(=O)N)C(=O)N2CCCC2C(=O)NC(CCC(=O)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC3=CC=CC=C3)C(=O)N)NC(=O)C(CC4=CC=CC=C4)N
InChIKey HWYCFZUSOBOBIN-AQJXLSMYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2 (CAS: 99566-27-5) typically synthesized?

Neuropeptide FF is synthesized using solid-phase peptide synthesis (SPPS) techniques. The process in...

Compound Q&A

What industries use Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2 (CAS: 99566-27-5)?

Neuropeptide FF finds applications primarily in the pharmaceutical industry for its role in studying...

Compound Q&A

What precautions should be taken when handling Neuropeptide FF H-Phe-Leu-Phe-Gln-Pro-Gln-Arg-Phe-NH2 (CAS: 99566-27-5)?

When handling Neuropeptide FF, it is crucial to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...