Compound Q&A

What precautions should be taken when handling Acetone diphenylamine (CAS: 68412-48-6)?

Answer

Acetone diphenylamine
When handling Acetone diphenylamine (CAS: 68412-48-6), it is crucial to follow safety guidelines to prevent adverse effects. Wear appropriate personal protective equipment (PPE) such as safety goggles, gloves, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Avoid contact with skin and eyes. Spills should be handled carefully using appropriate absorbents, and the area should be cleaned thoroughly. Always consult the Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

CAS No 68412-48-6
English Name Acetone diphenylamine
Molecular Formula C15H17NO
Molecular Weight 227.3 g/mol
SMILES CC(=O)C.C1=CC=C(C=C1)NC2=CC=CC=C2
InChIKey GZNRISJLOXVOSH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetone diphenylamine (CAS: 68412-48-6)?

Acetone diphenylamine (CAS: 68412-48-6) is a colorless or pale yellow liquid with a molecular weight...

Compound Q&A

How is Acetone diphenylamine (CAS: 68412-48-6) typically synthesized?

Acetone diphenylamine (CAS: 68412-48-6) is typically synthesized by the reaction of acetone with dip...

Compound Q&A

What industries use Acetone diphenylamine (CAS: 68412-48-6)?

Acetone diphenylamine (CAS: 68412-48-6) is used in various industries due to its unique properties. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...