Compound Q&A

What industries use Acetone diphenylamine (CAS: 68412-48-6)?

Answer

Acetone diphenylamine
Acetone diphenylamine (CAS: 68412-48-6) is used in various industries due to its unique properties. It is primarily used in the pharmaceutical industry as a stabilizer and preservative. It is also used in the polymer industry as a stabilizer and antioxidant. Additionally, it is utilized in the production of sensors and semiconductors due to its electronic properties. Its versatility makes it a valuable compound in many applications.

About

CAS No 68412-48-6
English Name Acetone diphenylamine
Molecular Formula C15H17NO
Molecular Weight 227.3 g/mol
SMILES CC(=O)C.C1=CC=C(C=C1)NC2=CC=CC=C2
InChIKey GZNRISJLOXVOSH-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetone diphenylamine (CAS: 68412-48-6)?

Acetone diphenylamine (CAS: 68412-48-6) is a colorless or pale yellow liquid with a molecular weight...

Compound Q&A

How is Acetone diphenylamine (CAS: 68412-48-6) typically synthesized?

Acetone diphenylamine (CAS: 68412-48-6) is typically synthesized by the reaction of acetone with dip...

Compound Q&A

What precautions should be taken when handling Acetone diphenylamine (CAS: 68412-48-6)?

When handling Acetone diphenylamine (CAS: 68412-48-6), it is crucial to follow safety guidelines to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...