Compound Q&A

What industries use 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9)?

Answer

3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone
3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) finds applications in pharmaceuticals, where it may serve as a precursor for natural product synthesis. It is also used in the development of new materials, particularly in the production of advanced polymers and sensors. Its unique chemical structure makes it valuable in research for developing novel materials and pharmaceuticals.

About

English Name 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone
Molecular Formula C27H40O6
Molecular Weight 460.6 g/mol
SMILES O=C1CCC(O1)(C)C1CC(C2(C1(C)CC(=O)C1=C2C(O)CC2C1(C)CCC(C2(C)C)O)C)O
InChIKey SRCUJKNQZOLYMY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9)?

3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) is a white crystalline so...

Compound Q&A

How is 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) typically synthesized?

3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) can be synthesized throug...

Compound Q&A

What precautions should be taken when handling 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9)?

When handling 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...