Compound Q&A

What are the physical and chemical properties of 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9)?

Answer

3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone
3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) is a white crystalline solid with a molecular weight of approximately 516.7 g/mol. It is sparingly soluble in organic solvents like methanol and ethanol, but insoluble in water. Chemically, it is stable under normal conditions but reacts with strong acids and bases. It exhibits minimal reactivity towards common nucleophiles.

About

English Name 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone
Molecular Formula C27H40O6
Molecular Weight 460.6 g/mol
SMILES O=C1CCC(O1)(C)C1CC(C2(C1(C)CC(=O)C1=C2C(O)CC2C1(C)CCC(C2(C)C)O)C)O
InChIKey SRCUJKNQZOLYMY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) typically synthesized?

3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) can be synthesized throug...

Compound Q&A

What industries use 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9)?

3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9) finds applications in pha...

Compound Q&A

What precautions should be taken when handling 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9)?

When handling 3β,7β,15β-trihydroxy-11-oxo-lanosta-8-en-24→20 lactone (CAS: 1694587-15-9), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...