Compound Q&A

What industries use 2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9)?

Answer

2-Bromo-3-chloro-5-nitropyridine
2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9) is primarily used in the pharmaceutical and pesticide industries. It serves as a key intermediate in the synthesis of several drug molecules. Additionally, this compound is employed in the development of sensors and semiconductors due to its unique electronic properties. Its use in organic synthesis also supports the growth of the chemical industry.

About

CAS No 22353-41-9
English Name 2-Bromo-3-chloro-5-nitropyridine
Molecular Formula C5H2BrClN2O2
Molecular Weight 237.44 g/mol
SMILES C1=C(C=NC(=C1Cl)Br)[N+](=O)[O-]
InChIKey VDVNBTTZUJOHJZ-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9)?

2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9) is a yellow or orange crystalline solid with a mo...

Compound Q&A

How is 2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9) typically synthesized?

2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9) is synthesized through the bromination of 3-chlor...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9)?

When handling 2-Bromo-3-chloro-5-nitropyridine (CAS: 22353-41-9), it is essential to follow strict s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...