Compound Q&A

What industries use 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5)?

Answer

5-Iodo-3-nitro-2-pyridinamine
5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5) is used in various industries. It is particularly valuable in the pharmaceutical industry for the synthesis of drug intermediates. Additionally, it finds applications in sensor technology and semiconductor manufacturing due to its unique chemical properties.

About

CAS No 25391-57-5
English Name 5-Iodo-3-nitro-2-pyridinamine
Molecular Formula C5H4IN3O2
Molecular Weight 265.01 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])N)I
InChIKey MDJUWRHSXKZSOJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5)?

5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5) is a crystalline compound with a molecular weight of...

Compound Q&A

How is 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5) typically synthesized?

5-Iodo-3-nitro-2-pyridinamine is typically synthesized via a multistep process. One common method in...

Compound Q&A

What precautions should be taken when handling 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5)?

When handling 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...