Compound Q&A

How is 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5) typically synthesized?

Answer

5-Iodo-3-nitro-2-pyridinamine
5-Iodo-3-nitro-2-pyridinamine is typically synthesized via a multistep process. One common method involves the nitration of 2-pyridinamine followed by iodination. The synthesis typically requires the use of nitric acid and sulfuric acid as reagents, with careful control of reaction conditions to achieve high selectivity and yield.

About

CAS No 25391-57-5
English Name 5-Iodo-3-nitro-2-pyridinamine
Molecular Formula C5H4IN3O2
Molecular Weight 265.01 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])N)I
InChIKey MDJUWRHSXKZSOJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5)?

5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5) is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5)?

5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5) is used in various industries. It is particularly va...

Compound Q&A

What precautions should be taken when handling 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5)?

When handling 5-Iodo-3-nitro-2-pyridinamine (CAS: 25391-57-5), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...