Compound Q&A

What industries use 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3)?

Answer

4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate
4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a modifier and in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate
Molecular Formula C15H27NO4
Molecular Weight 285.38 g/mol
SMILES CCC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OCC
InChIKey JLXSBKSGHPCYMR-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3)?

4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate is a crystalline compound with a...

Compound Q&A

How is 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3) typically synthesized?

4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate is synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3)?

When handling 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate, it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...