Compound Q&A

What are the physical and chemical properties of 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3)?

Answer

4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate
4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate is a crystalline compound with a molecular weight of approximately 312.45 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and dichloromethane. Chemically, it exhibits typical ester and dicarboxylic acid reactivity, making it suitable for various synthetic applications.

About

English Name 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate
Molecular Formula C15H27NO4
Molecular Weight 285.38 g/mol
SMILES CCC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OCC
InChIKey JLXSBKSGHPCYMR-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3) typically synthesized?

4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate is synthesized through a multi-s...

Compound Q&A

What industries use 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3)?

4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate (CAS: 188792-70-3)?

When handling 4-Ethyl 1-(2-methyl-2-propanyl) 4-ethyl-1,4-piperidinedicarboxylate, it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...