Compound Q&A

What industries use O-Xylene-d10 (CAS: 56004-61-6)?

Answer

O-Xylene-d10
O-Xylene-d10 (CAS: 56004-61-6) is primarily used in the production of polymers, particularly polyethylene terephthalate (PET), which is used in packaging, fibers, and films. It is also utilized in the synthesis of various chemical intermediates and solvents for pharmaceuticals and electronics.

About

CAS No 56004-61-6
English Name O-Xylene-d10
Molecular Formula C8D10
Molecular Weight 116.23 g/mol
SMILES c1([2H])c([2H])c(c(c(c1[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H]
InChIKey CTQNGGLPUBDAKN-ZGYYUIRESA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of O-Xylene-d10 (CAS: 56004-61-6)?

O-Xylene-d10 (CAS: 56004-61-6) is a colorless, flammable liquid with a molecular weight of approxima...

Compound Q&A

How is O-Xylene-d10 (CAS: 56004-61-6) typically synthesized?

O-Xylene-d10 (CAS: 56004-61-6) is synthesized via the isomerization of xylenes catalyzed by zeolite-...

Compound Q&A

What precautions should be taken when handling O-Xylene-d10 (CAS: 56004-61-6)?

When handling O-Xylene-d10 (CAS: 56004-61-6), proper personal protective equipment (PPE) such as saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...