Compound Q&A

What are the physical and chemical properties of O-Xylene-d10 (CAS: 56004-61-6)?

Answer

O-Xylene-d10
O-Xylene-d10 (CAS: 56004-61-6) is a colorless, flammable liquid with a molecular weight of approximately 144.23 g/mol. It has a boiling point of 144.1°C and a melting point of -33.7°C. The compound is sparingly soluble in water but miscible with most organic solvents. It is relatively stable under normal conditions but can react with strong oxidizers. O-Xylene-d10 is used in the production of polymers and other chemical intermediates.

About

CAS No 56004-61-6
English Name O-Xylene-d10
Molecular Formula C8D10
Molecular Weight 116.23 g/mol
SMILES c1([2H])c([2H])c(c(c(c1[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H]
InChIKey CTQNGGLPUBDAKN-ZGYYUIRESA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is O-Xylene-d10 (CAS: 56004-61-6) typically synthesized?

O-Xylene-d10 (CAS: 56004-61-6) is synthesized via the isomerization of xylenes catalyzed by zeolite-...

Compound Q&A

What industries use O-Xylene-d10 (CAS: 56004-61-6)?

O-Xylene-d10 (CAS: 56004-61-6) is primarily used in the production of polymers, particularly polyeth...

Compound Q&A

What precautions should be taken when handling O-Xylene-d10 (CAS: 56004-61-6)?

When handling O-Xylene-d10 (CAS: 56004-61-6), proper personal protective equipment (PPE) such as saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...