Compound Q&A

What industries use 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5)?

Answer

2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1)
2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the production of functionalized polymers, and in the sensor industry for the development of new detection techniques due to its unique chemical properties.

About

CAS No 2174-16-5
English Name 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1)
Molecular Formula C13H21NO6
Molecular Weight 287.31 g/mol
SMILES c1ccc(c(c1)C(=O)O)O.C(CO)N(CCO)CCO
InChIKey UEVAMYPIMMOEFW-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5)?

2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) is a crystalline solid wit...

Compound Q&A

How is 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) typically synthesized?

2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) is typically synthesized t...

Compound Q&A

What precautions should be taken when handling 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5)?

When handling 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...