Compound Q&A

What are the physical and chemical properties of 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5)?

Answer

2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1)
2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) is a crystalline solid with a molecular weight of approximately 350.24 g/mol. It has a solubility of about 2.5 g/100 mL in water at 25°C. Chemically, it exhibits moderate acidity and can undergo esterification and nitration reactions.

About

CAS No 2174-16-5
English Name 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1)
Molecular Formula C13H21NO6
Molecular Weight 287.31 g/mol
SMILES c1ccc(c(c1)C(=O)O)O.C(CO)N(CCO)CCO
InChIKey UEVAMYPIMMOEFW-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) typically synthesized?

2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) is typically synthesized t...

Compound Q&A

What industries use 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5)?

2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5) is used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5)?

When handling 2-Hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) (CAS: 2174-16-5), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...