Compound Q&A

What industries use Cyanoferrocene (CAS: 1273-84-3)?

Answer

Cyanoferrocene
Cyanoferrocene (CAS: 1273-84-3) is used in several industries, particularly in the pharmaceuticals sector for the development of anticancer agents. It also finds applications in the polymer industry for modifying polymer properties, in sensors for its unique redox behavior, and in semiconductors due to its electronic properties.

About

CAS No 1273-84-3
English Name Cyanoferrocene
Molecular Formula C11FeN
Molecular Weight 201.97 g/mol
SMILES N#C[C-]12C3=C4[Fe+2]5678923(C1=C45)[C-]1C6=C8C9=C71
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyanoferrocene (CAS: 1273-84-3)?

Cyanoferrocene (CAS: 1273-84-3) is a dicyano derivative of ferrocene. It is a crystalline solid with...

Compound Q&A

How is Cyanoferrocene (CAS: 1273-84-3) typically synthesized?

Cyanoferrocene (CAS: 1273-84-3) can be synthesized by the reaction of ferrocene with cyanogen chlori...

Compound Q&A

What precautions should be taken when handling Cyanoferrocene (CAS: 1273-84-3)?

When handling Cyanoferrocene (CAS: 1273-84-3), it is essential to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...