Compound Q&A

What are the physical and chemical properties of Cyanoferrocene (CAS: 1273-84-3)?

Answer

Cyanoferrocene
Cyanoferrocene (CAS: 1273-84-3) is a dicyano derivative of ferrocene. It is a crystalline solid with a molecular weight of approximately 214.11 g/mol. This compound has limited solubility in organic solvents such as benzene and toluene. It is known for its low reactivity in comparison to other ferrocene derivatives, making it useful in various synthetic applications.

About

CAS No 1273-84-3
English Name Cyanoferrocene
Molecular Formula C11FeN
Molecular Weight 201.97 g/mol
SMILES N#C[C-]12C3=C4[Fe+2]5678923(C1=C45)[C-]1C6=C8C9=C71
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is Cyanoferrocene (CAS: 1273-84-3) typically synthesized?

Cyanoferrocene (CAS: 1273-84-3) can be synthesized by the reaction of ferrocene with cyanogen chlori...

Compound Q&A

What industries use Cyanoferrocene (CAS: 1273-84-3)?

Cyanoferrocene (CAS: 1273-84-3) is used in several industries, particularly in the pharmaceuticals s...

Compound Q&A

What precautions should be taken when handling Cyanoferrocene (CAS: 1273-84-3)?

When handling Cyanoferrocene (CAS: 1273-84-3), it is essential to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...