Compound Q&A

What precautions should be taken when handling 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6)?

Answer

6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine
Proper handling requires the use of personal protective equipment (PPE) such as gloves and eye protection. The compound should be stored in a cool, dry place away from direct sunlight. In case of spill, ensure proper ventilation and use appropriate spill kits. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine
Molecular Formula C28H30N8O
Molecular Weight 494.6 g/mol
SMILES O1CCN(CC1)c1nc(nc2c1cnn2C1CCN(CC1)Cc1cccnc1)c1ccc2c(c1)cc[nH]2
InChIKey FPEIJQLXFHKLJV-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6)?

This compound is a crystalline solid with a molecular weight of approximately 538.59 g/mol. It shows...

Compound Q&A

How is 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6) typically synthesized?

This compound is typically synthesized via multi-step reactions involving the coupling of indolyl an...

Compound Q&A

What industries use 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6)?

This compound is primarily used in the pharmaceutical industry as an intermediate for developing new...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...