Compound Q&A

How is 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6) typically synthesized?

Answer

6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine
This compound is typically synthesized via multi-step reactions involving the coupling of indolyl and piperidinyl moieties. The reaction involves the use of a palladium catalyst under microwave-assisted conditions, providing a yield of up to 75%. The synthesis also requires precise control of temperature and reagent concentrations to achieve the desired selectivity.

About

English Name 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine
Molecular Formula C28H30N8O
Molecular Weight 494.6 g/mol
SMILES O1CCN(CC1)c1nc(nc2c1cnn2C1CCN(CC1)Cc1cccnc1)c1ccc2c(c1)cc[nH]2
InChIKey FPEIJQLXFHKLJV-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6)?

This compound is a crystalline solid with a molecular weight of approximately 538.59 g/mol. It shows...

Compound Q&A

What industries use 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6)?

This compound is primarily used in the pharmaceutical industry as an intermediate for developing new...

Compound Q&A

What precautions should be taken when handling 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine (CAS: 1062159-35-6)?

Proper handling requires the use of personal protective equipment (PPE) such as gloves and eye prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...