Compound Q&A

What industries use Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0)?

Answer

Methyl 4-(bromomethyl)-2-methoxybenzoate
Methyl 4-(bromomethyl)-2-methoxybenzoate is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a monomer or functionalizing agent. Additionally, it has potential uses in the development of advanced materials and sensors due to its chemical reactivity.

About

CAS No 74733-27-0
English Name Methyl 4-(bromomethyl)-2-methoxybenzoate
Molecular Formula C10H11BrO3
Molecular Weight 259.1 g/mol
SMILES COC1=C(C=CC(=C1)CBr)C(=O)OC
InChIKey DCXFLSHDURQRML-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0)?

Methyl 4-(bromomethyl)-2-methoxybenzoate is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0) typically synthesized?

Methyl 4-(bromomethyl)-2-methoxybenzoate can be synthesized via a bromination reaction of 4-hydroxym...

Compound Q&A

What precautions should be taken when handling Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0)?

When handling Methyl 4-(bromomethyl)-2-methoxybenzoate, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...