Compound Q&A

How is Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0) typically synthesized?

Answer

Methyl 4-(bromomethyl)-2-methoxybenzoate
Methyl 4-(bromomethyl)-2-methoxybenzoate can be synthesized via a bromination reaction of 4-hydroxymethyl-2-methoxybenzoic acid with bromine in the presence of a Lewis acid catalyst such as aluminum bromide. The reaction typically proceeds with good selectivity and high yield under anhydrous conditions. The product is then purified by recrystallization from acetonitrile.

About

CAS No 74733-27-0
English Name Methyl 4-(bromomethyl)-2-methoxybenzoate
Molecular Formula C10H11BrO3
Molecular Weight 259.1 g/mol
SMILES COC1=C(C=CC(=C1)CBr)C(=O)OC
InChIKey DCXFLSHDURQRML-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0)?

Methyl 4-(bromomethyl)-2-methoxybenzoate is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0)?

Methyl 4-(bromomethyl)-2-methoxybenzoate is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling Methyl 4-(bromomethyl)-2-methoxybenzoate (CAS: 74733-27-0)?

When handling Methyl 4-(bromomethyl)-2-methoxybenzoate, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...