Compound Q&A

What industries use (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4)?

Answer

(4-Chloro-1-naphthyl)boronic acid
(4-Chloro-1-naphthyl)boronic acid finds application in various industries, particularly in pharmaceuticals and organic synthesis. It serves as a key reagent in the synthesis of complex organic molecules and pharmaceutical intermediates. Its use in polymer chemistry and sensor technology is also growing, leveraging its boronic acid functionality for specific chemical interactions and reactivities.

About

English Name (4-Chloro-1-naphthyl)boronic acid
Molecular Formula C10H8BClO2
Molecular Weight 206.44 g/mol
SMILES B(C1=CC=C(C2=CC=CC=C12)Cl)(O)O
InChIKey PIHWNQAUHGAUGC-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4)?

(4-Chloro-1-naphthyl)boronic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

How is (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4) typically synthesized?

(4-Chloro-1-naphthyl)boronic acid is usually synthesized via the reaction of chloronaphthalene with ...

Compound Q&A

What precautions should be taken when handling (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4)?

When handling (4-Chloro-1-naphthyl)boronic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...