Compound Q&A

What are the physical and chemical properties of (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4)?

Answer

(4-Chloro-1-naphthyl)boronic acid
(4-Chloro-1-naphthyl)boronic acid is a white crystalline solid with a molecular weight of approximately 231.03 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound displays moderate reactivity, particularly in reactions involving boronic acid functional groups, such as Suzuki coupling. Its physical properties include a melting point of 151-153°C and a specific rotation of -10 to -15°.

About

English Name (4-Chloro-1-naphthyl)boronic acid
Molecular Formula C10H8BClO2
Molecular Weight 206.44 g/mol
SMILES B(C1=CC=C(C2=CC=CC=C12)Cl)(O)O
InChIKey PIHWNQAUHGAUGC-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4) typically synthesized?

(4-Chloro-1-naphthyl)boronic acid is usually synthesized via the reaction of chloronaphthalene with ...

Compound Q&A

What industries use (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4)?

(4-Chloro-1-naphthyl)boronic acid finds application in various industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling (4-Chloro-1-naphthyl)boronic acid (CAS: 147102-97-4)?

When handling (4-Chloro-1-naphthyl)boronic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...