Compound Q&A

What industries use tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6)?

Answer

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate
tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate is primarily used in pharmaceutical research, polymer synthesis, and sensor applications. Its unique structure makes it an important intermediate in the synthesis of complex molecules. It is also utilized in the preparation of polymers and as a reagent in organic chemistry due to its stability and reactivity.

About

English Name tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate
Molecular Formula C11H17NO3
Molecular Weight 211.26 g/mol
SMILES CC(C)(C)OC(=O)N1C2CCC1C(=O)C2
InChIKey XWIJVOQGKJHEAJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6)?

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate is a white crystalline solid with a molec...

Compound Q&A

How is tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6) typically synthesized?

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate can be synthesized via a multi-step proce...

Compound Q&A

What precautions should be taken when handling tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6)?

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate should be handled in a well-ventilated ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...