Compound Q&A

How is tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6) typically synthesized?

Answer

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate
tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate can be synthesized via a multi-step process, starting from 3,7-dimethyl-2,6-octadiene-1,5-dione. The reaction involves the epoxidation of the diene followed by an intramolecular Diels-Alder reaction, followed by protection and deprotection steps. This compound is commonly synthesized using catalytic amounts of acid or base, with high yields and good regioselectivity.

About

English Name tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate
Molecular Formula C11H17NO3
Molecular Weight 211.26 g/mol
SMILES CC(C)(C)OC(=O)N1C2CCC1C(=O)C2
InChIKey XWIJVOQGKJHEAJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6)?

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate is a white crystalline solid with a molec...

Compound Q&A

What industries use tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6)?

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate is primarily used in pharmaceutical resea...

Compound Q&A

What precautions should be taken when handling tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS: 152533-47-6)?

tert-Butyl 2-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate should be handled in a well-ventilated ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...