Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-chloro-1-nitrobenzene (CAS: 63860-31-1)?

Answer

2-Bromo-4-chloro-1-nitrobenzene
2-Bromo-4-chloro-1-nitrobenzene (CAS: 63860-31-1) is a crystalline solid with a molecular weight of approximately 230.02 g/mol. It has poor water solubility but is soluble in organic solvents like ethanol and acetone. This compound is known for its reactivity, particularly in electrophilic aromatic substitution reactions. It is used in the synthesis of various aromatic compounds and pharmaceutical intermediates.

About

CAS No 63860-31-1
English Name 2-Bromo-4-chloro-1-nitrobenzene
Molecular Formula C6H3BrClNO2
Molecular Weight 236.4505 g/mol
SMILES C1=CC(=C(C=C1Cl)Br)[N+](=O)[O-]
InChIKey VFMAPIFSXMBTQP-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is 2-Bromo-4-chloro-1-nitrobenzene (CAS: 63860-31-1) typically synthesized?

2-Bromo-4-chloro-1-nitrobenzene can be synthesized through the nitration of 4-chlorobromobenzene. Th...

Compound Q&A

What industries use 2-Bromo-4-chloro-1-nitrobenzene (CAS: 63860-31-1)?

2-Bromo-4-chloro-1-nitrobenzene is primarily used in the pharmaceutical and chemical industries as a...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-chloro-1-nitrobenzene (CAS: 63860-31-1)?

When handling 2-Bromo-4-chloro-1-nitrobenzene (CAS: 63860-31-1), it is essential to wear appropriate...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...