Compound Q&A

What industries use Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4)?

Answer

Ethyl 2,6-dichloronicotinate
Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the chemical industry for the production of dyes and pigments. Additionally, it can be used in the research and development of new materials, particularly in the fabrication of sensors and semiconductors.

About

CAS No 58584-86-4
English Name Ethyl 2,6-dichloronicotinate
Molecular Formula C8H7Cl2NO2
Molecular Weight 220.05 g/mol
SMILES CCOC(=O)C1=C(N=C(C=C1)Cl)Cl
InChIKey KKYBVLDQTWQETN-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4)?

Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) typically synthesized?

Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) can be synthesized via the reaction of 2,6-dichloroni...

Compound Q&A

What precautions should be taken when handling Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4)?

When handling Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...