Compound Q&A

How is Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) typically synthesized?

Answer

Ethyl 2,6-dichloronicotinate
Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) can be synthesized via the reaction of 2,6-dichloronicotinic acid with ethylamine in the presence of a base like sodium hydroxide. The process involves heating the mixture to promote the nucleophilic substitution reaction, followed by acidification to isolate the product. High selectivity and yield can be achieved with proper temperature and concentration control.

About

CAS No 58584-86-4
English Name Ethyl 2,6-dichloronicotinate
Molecular Formula C8H7Cl2NO2
Molecular Weight 220.05 g/mol
SMILES CCOC(=O)C1=C(N=C(C=C1)Cl)Cl
InChIKey KKYBVLDQTWQETN-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4)?

Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4)?

Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4) is primarily used in the pharmaceutical industry as a...

Compound Q&A

What precautions should be taken when handling Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4)?

When handling Ethyl 2,6-dichloronicotinate (CAS: 58584-86-4), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...