Compound Q&A

What precautions should be taken when handling 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5)?

Answer

2,2-Dichloro-1-phenylethanone
When handling 2,2-Dichloro-1-phenylethanone, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure to vapors. Spills should be cleaned up using appropriate procedures, and disposal should follow local regulations. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 2648-61-5
English Name 2,2-Dichloro-1-phenylethanone
Molecular Formula C8H6Cl2O
Molecular Weight 189.04 g/mol
SMILES C1=CC=C(C=C1)C(=O)C(Cl)Cl
InChIKey CERJZAHSUZVMCH-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5)?

2,2-Dichloro-1-phenylethanone has a crystalline form with a molecular weight of approximately 234.08...

Compound Q&A

How is 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5) typically synthesized?

2,2-Dichloro-1-phenylethanone is typically synthesized via a condensation reaction between chloroace...

Compound Q&A

What industries use 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5)?

2,2-Dichloro-1-phenylethanone is used in various industries, including pharmaceuticals, as an interm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...