Compound Q&A

What are the physical and chemical properties of 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5)?

Answer

2,2-Dichloro-1-phenylethanone
2,2-Dichloro-1-phenylethanone has a crystalline form with a molecular weight of approximately 234.08 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive towards nucleophiles, making it useful in various synthetic processes. It has a melting point of 62-64°C and a boiling point of 218°C. Its reactivity is due to the presence of electron-withdrawing chlorine substituents.

About

CAS No 2648-61-5
English Name 2,2-Dichloro-1-phenylethanone
Molecular Formula C8H6Cl2O
Molecular Weight 189.04 g/mol
SMILES C1=CC=C(C=C1)C(=O)C(Cl)Cl
InChIKey CERJZAHSUZVMCH-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5) typically synthesized?

2,2-Dichloro-1-phenylethanone is typically synthesized via a condensation reaction between chloroace...

Compound Q&A

What industries use 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5)?

2,2-Dichloro-1-phenylethanone is used in various industries, including pharmaceuticals, as an interm...

Compound Q&A

What precautions should be taken when handling 2,2-Dichloro-1-phenylethanone (CAS: 2648-61-5)?

When handling 2,2-Dichloro-1-phenylethanone, it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...