Compound Q&A

What industries use Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3)?

Answer

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate
Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate is used in the pharmaceutical industry for the synthesis of various biologically active compounds. It is also utilized in the chemical industry for applications in polymers and materials science, particularly in the development of sensors and semiconductors due to its unique chemical reactivity and functional groups.

About

English Name Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate
Molecular Formula C7H6BrNO3
Molecular Weight 232.03 g/mol
SMILES COC(=O)C1=CC=C(C(=O)N1)Br
InChIKey OZVOYEXCBCAMNC-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3)?

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate is a white crystalline solid with a molecular...

Compound Q&A

How is Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3) typically synthesized?

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate is typically synthesized via the bromination ...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3)?

When handling Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...