Compound Q&A

How is Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3) typically synthesized?

Answer

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate
Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate is typically synthesized via the bromination of methyl 6-oxo-1,6-dihydropyridine-2-carboxylate using N-bromosuccinimide (NBS) in the presence of a suitable catalyst like azobisisobutyronitrile (AIBN). This process yields a high selectivity towards bromination and provides good yields. The reaction is usually carried out in an inert solvent such as dichloromethane under UV light conditions.

About

English Name Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate
Molecular Formula C7H6BrNO3
Molecular Weight 232.03 g/mol
SMILES COC(=O)C1=CC=C(C(=O)N1)Br
InChIKey OZVOYEXCBCAMNC-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3)?

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate is a white crystalline solid with a molecular...

Compound Q&A

What industries use Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3)?

Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate (CAS: 178876-86-3)?

When handling Methyl 5-bromo-6-oxo-1,6-dihydropyridine-2-carboxylate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...