Compound Q&A

What industries use ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5)?

Answer

ethyl 4-amino-3-methylbenzoate
Ethyl 4-amino-3-methylbenzoate is used in various industries, including pharmaceuticals for intermediate production, and dye-making for colorants in textiles. It also finds applications in polymer-based coatings and as a sensor component in chemical sensors.

About

CAS No 40800-65-5
English Name ethyl 4-amino-3-methylbenzoate
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1)N)C
InChIKey JUKRQDBAJXYXIR-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5)?

Ethyl 4-amino-3-methylbenzoate is a crystalline compound with a molecular weight of approximately 19...

Compound Q&A

How is ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5) typically synthesized?

Ethyl 4-amino-3-methylbenzoate is typically synthesized from 4-amino-3-methylbenzoic acid and ethyl ...

Compound Q&A

What precautions should be taken when handling ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5)?

Precautions when handling ethyl 4-amino-3-methylbenzoate include using personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...