Compound Q&A

How is ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5) typically synthesized?

Answer

ethyl 4-amino-3-methylbenzoate
Ethyl 4-amino-3-methylbenzoate is typically synthesized from 4-amino-3-methylbenzoic acid and ethyl bromide in the presence of a base like sodium hydride. The reaction involves nucleophilic substitution, yielding the desired product with good yield. This method ensures high selectivity and purity of the final compound.

About

CAS No 40800-65-5
English Name ethyl 4-amino-3-methylbenzoate
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1)N)C
InChIKey JUKRQDBAJXYXIR-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5)?

Ethyl 4-amino-3-methylbenzoate is a crystalline compound with a molecular weight of approximately 19...

Compound Q&A

What industries use ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5)?

Ethyl 4-amino-3-methylbenzoate is used in various industries, including pharmaceuticals for intermed...

Compound Q&A

What precautions should be taken when handling ethyl 4-amino-3-methylbenzoate (CAS: 40800-65-5)?

Precautions when handling ethyl 4-amino-3-methylbenzoate include using personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...