Compound Q&A

What industries use 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2)?

Answer

6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride
6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of certain drugs. It is also utilized in the production of sensors and in the development of certain polymers. The compound's unique structure makes it useful in applications requiring specific chemical properties.

About

CAS No 92028-21-2
English Name 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride
Molecular Formula C13H14ClNO
Molecular Weight 235.71 g/mol
SMILES COC1=C(C=C(C=C1)N)C2=CC=CC=C2.Cl
InChIKey ONIVGWWTHRIXHL-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2)?

6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2) typically synthesized?

6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is typically synthesized via a multistep process inv...

Compound Q&A

What precautions should be taken when handling 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2)?

When handling 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...