Compound Q&A

How is 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2) typically synthesized?

Answer

6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride
6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is typically synthesized via a multistep process involving the coupling of 1,1'-biphenyl and 6-methoxy-3-aminophenol. The reaction is catalyzed by a suitable base, such as sodium hydride, and is performed in a suitable organic solvent. The overall yield is moderate, and the product is isolated by crystallization from an appropriate solvent.

About

CAS No 92028-21-2
English Name 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride
Molecular Formula C13H14ClNO
Molecular Weight 235.71 g/mol
SMILES COC1=C(C=C(C=C1)N)C2=CC=CC=C2.Cl
InChIKey ONIVGWWTHRIXHL-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2)?

6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2)?

6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride (CAS: 92028-21-2)?

When handling 6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...