Compound Q&A

What industries use 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6)?

Answer

2-Methyl-4-(trifluoromethyl)phenylboronic acid
2-Methyl-4-(trifluoromethyl)phenylboronic acid finds application in the pharmaceutical industry for drug synthesis, particularly in the development of novel drug candidates. It is also used in the synthesis of polymers and in the preparation of functional materials for sensors and semiconductors.

About

English Name 2-Methyl-4-(trifluoromethyl)phenylboronic acid
Molecular Formula C8H8BF3O2
Molecular Weight 203.96 g/mol
SMILES B(C1=C(C=C(C=C1)C(F)(F)F)C)(O)O
InChIKey USEHFBIGOATLIA-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6)?

2-Methyl-4-(trifluoromethyl)phenylboronic acid has a crystalline form with a molecular weight of app...

Compound Q&A

How is 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6) typically synthesized?

2-Methyl-4-(trifluoromethyl)phenylboronic acid is typically synthesized via a Suzuki-Miyaura couplin...

Compound Q&A

What precautions should be taken when handling 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6)?

When handling 2-Methyl-4-(trifluoromethyl)phenylboronic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...