Compound Q&A

How is 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6) typically synthesized?

Answer

2-Methyl-4-(trifluoromethyl)phenylboronic acid
2-Methyl-4-(trifluoromethyl)phenylboronic acid is typically synthesized via a Suzuki-Miyaura coupling reaction. The synthesis involves the reaction of 2-methyl-4-(trifluoromethyl)phenylboronic pinacol ester with a boronate ester in the presence of a palladium catalyst, such as Pd(PPh3)4, and a base like sodium carbonate or potassium carbonate.

About

English Name 2-Methyl-4-(trifluoromethyl)phenylboronic acid
Molecular Formula C8H8BF3O2
Molecular Weight 203.96 g/mol
SMILES B(C1=C(C=C(C=C1)C(F)(F)F)C)(O)O
InChIKey USEHFBIGOATLIA-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6)?

2-Methyl-4-(trifluoromethyl)phenylboronic acid has a crystalline form with a molecular weight of app...

Compound Q&A

What industries use 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6)?

2-Methyl-4-(trifluoromethyl)phenylboronic acid finds application in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-4-(trifluoromethyl)phenylboronic acid (CAS: 957034-45-6)?

When handling 2-Methyl-4-(trifluoromethyl)phenylboronic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...