Compound Q&A

What industries use Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4)?

Answer

Diisobutyl (2E)-2-butenedioate
Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) is primarily used in the pharmaceutical and polymer industries. It serves as a monomer in the synthesis of copolymers and as a plasticizer in the production of flexible polyurethane foams. Additionally, it is utilized in the manufacturing of sensors and as an intermediate in the synthesis of other chemical compounds.

About

CAS No 7283-69-4
English Name Diisobutyl (2E)-2-butenedioate
Molecular Formula C12H20O4
Molecular Weight 228.29 g/mol
SMILES CC(C)COC(=O)C=CC(=O)OCC(C)C
InChIKey RSRICHZMFPHXLE-AATRIKPKSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4)?

Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) is a colorless, crystalline solid with a molecular w...

Compound Q&A

How is Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) typically synthesized?

Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) is commonly synthesized via esterification of maleic...

Compound Q&A

What precautions should be taken when handling Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4)?

When handling Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...