Compound Q&A

How is Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) typically synthesized?

Answer

Diisobutyl (2E)-2-butenedioate
Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) is commonly synthesized via esterification of maleic anhydride with diisobutyl alcohol. The reaction is typically catalyzed by a strong acid like sulfuric acid. The yield is around 85-90%, with high selectivity towards the desired product. The reaction is monitored by thin-layer chromatography (TLC) to ensure purity.

About

CAS No 7283-69-4
English Name Diisobutyl (2E)-2-butenedioate
Molecular Formula C12H20O4
Molecular Weight 228.29 g/mol
SMILES CC(C)COC(=O)C=CC(=O)OCC(C)C
InChIKey RSRICHZMFPHXLE-AATRIKPKSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4)?

Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) is a colorless, crystalline solid with a molecular w...

Compound Q&A

What industries use Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4)?

Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4) is primarily used in the pharmaceutical and polymer ...

Compound Q&A

What precautions should be taken when handling Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4)?

When handling Diisobutyl (2E)-2-butenedioate (CAS: 7283-69-4), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...