Compound Q&A

What are the physical and chemical properties of Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5)?

Answer

Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)-
Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5) is a crystalline compound with a molecular weight of approximately 359.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. The compound is relatively stable but can react with bases to form salts. It is an important intermediate in steroid synthesis.

About

CAS No 15833-07-5
English Name Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)-
Molecular Formula C18H23BrO2
Molecular Weight 351.28 g/mol
SMILES CC12CCC3C(C1CCC2O)CCC4=CC(=C(C=C34)Br)O
InChIKey SORISAYAZBCIQH-XSSYPUMDSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5) typically synthesized?

Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5) is typically synthesized throug...

Compound Q&A

What industries use Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5)?

Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5)?

When handling Estra-1,3,5(10)-triene-3,17-diol, 2-bromo-, (17β)- (CAS: 15833-07-5), always wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...