Compound Q&A

What precautions should be taken when handling 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6)?

Answer

3-Bromo-4,5-difluorobenzoic acid
When handling 3-Bromo-4,5-difluorobenzoic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. The material should be handled in a well-ventilated area or a fume hood to minimize exposure to bromine vapor. Spills should be immediately cleaned up according to the Material Safety Data Sheet (MSDS/SDS).

About

English Name 3-Bromo-4,5-difluorobenzoic acid
Molecular Formula C7H3BrF2O2
Molecular Weight 237 g/mol
SMILES C1=C(C=C(C(=C1F)F)Br)C(=O)O
InChIKey PBUNICLVOHJWRN-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6)?

3-Bromo-4,5-difluorobenzoic acid is a crystalline solid with a molecular weight of approximately 225...

Compound Q&A

How is 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6) typically synthesized?

3-Bromo-4,5-difluorobenzoic acid is synthesized by bromination of 4,5-difluorobenzoic acid using bro...

Compound Q&A

What industries use 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6)?

3-Bromo-4,5-difluorobenzoic acid is used in the pharmaceutical industry for the synthesis of various...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...