Compound Q&A

What industries use 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6)?

Answer

3-Bromo-4,5-difluorobenzoic acid
3-Bromo-4,5-difluorobenzoic acid is used in the pharmaceutical industry for the synthesis of various medicinals, in the polymer industry for the modification of certain plastics, and in the sensor industry for the development of gas sensing materials. It is also utilized in the semiconductor industry for the production of certain electronic components.

About

English Name 3-Bromo-4,5-difluorobenzoic acid
Molecular Formula C7H3BrF2O2
Molecular Weight 237 g/mol
SMILES C1=C(C=C(C(=C1F)F)Br)C(=O)O
InChIKey PBUNICLVOHJWRN-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6)?

3-Bromo-4,5-difluorobenzoic acid is a crystalline solid with a molecular weight of approximately 225...

Compound Q&A

How is 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6) typically synthesized?

3-Bromo-4,5-difluorobenzoic acid is synthesized by bromination of 4,5-difluorobenzoic acid using bro...

Compound Q&A

What precautions should be taken when handling 3-Bromo-4,5-difluorobenzoic acid (CAS: 1244642-73-6)?

When handling 3-Bromo-4,5-difluorobenzoic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...